C24H27N5O4 — CID 55968280
2-butyl-N-[6-(3-carbamoylpiperidin-1-yl)-3-pyridinyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55968280) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-butyl-N-[6-(3-carbamoylpiperidin-1-yl)-3-pyridinyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-butyl-N-[6-(3-carbamoylpiperidin-1-yl)-3-pyridinyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55968280 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 2-butyl-N-[6-(3-carbamoylpiperidin-1-yl)-3-pyridinyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)Nc3ccc(N4CCCC(C(N)=O)C4)nc3)cc2C1=O |
| InChI | InChI=1S/C24H27N5O4/c1-2-3-11-29-23(32)18-8-6-15(12-19(18)24(29)33)22(31)27-17-7-9-20(26-13-17)28-10-4-5-16(14-28)21(25)30/h6-9,12-13,16H,2-5,10-11,14H2,1H3,(H2,25,30)(H,27,31) |
| InChIKey | JZXPWWVLYIDSAJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|