C19H19F3N4O2S — CID 55701002
1-[5-[[4-(trifluoromethylsulfanyl)benzoyl]amino]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 55701002) has the molecular formula C19H19F3N4O2S and a molecular weight of 424.45 g/mol. Its IUPAC name is 1-[5-[[4-(trifluoromethylsulfanyl)benzoyl]amino]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[5-[[4-(trifluoromethylsulfanyl)benzoyl]amino]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55701002 |
| Molecular Formula | C19H19F3N4O2S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1-[5-[[4-(trifluoromethylsulfanyl)benzoyl]amino]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(c2ccc(NC(=O)c3ccc(SC(F)(F)F)cc3)cn2)C1 |
| InChI | InChI=1S/C19H19F3N4O2S/c20-19(21,22)29-15-6-3-12(4-7-15)18(28)25-14-5-8-16(24-10-14)26-9-1-2-13(11-26)17(23)27/h3-8,10,13H,1-2,9,11H2,(H2,23,27)(H,25,28) |
| InChIKey | AGAFOJVPWCMFQP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |