C25H33N5O4S — CID 55971087
1-[5-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 55971087) has the molecular formula C25H33N5O4S and a molecular weight of 499.64 g/mol. Its IUPAC name is 1-[5-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[5-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55971087 |
| Molecular Formula | C25H33N5O4S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 1-[5-[[4-[cyclohexyl(methyl)sulfamoyl]benzoyl]amino]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)Nc2ccc(N3CCCC(C(N)=O)C3)nc2)cc1 |
| InChI | InChI=1S/C25H33N5O4S/c1-29(21-7-3-2-4-8-21)35(33,34)22-12-9-18(10-13-22)25(32)28-20-11-14-23(27-16-20)30-15-5-6-19(17-30)24(26)31/h9-14,16,19,21H,2-8,15,17H2,1H3,(H2,26,31)(H,28,32) |
| InChIKey | PZJFPCRKANRFHW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |