C20H26N4O3S — CID 86967490
1-[5-[(4-propan-2-ylphenyl)sulfonylamino]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 86967490) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 1-[5-[(4-propan-2-ylphenyl)sulfonylamino]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[5-[(4-propan-2-ylphenyl)sulfonylamino]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 86967490 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[5-[(4-propan-2-ylphenyl)sulfonylamino]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)Nc2ccc(N3CCCC(C(N)=O)C3)nc2)cc1 |
| InChI | InChI=1S/C20H26N4O3S/c1-14(2)15-5-8-18(9-6-15)28(26,27)23-17-7-10-19(22-12-17)24-11-3-4-16(13-24)20(21)25/h5-10,12,14,16,23H,3-4,11,13H2,1-2H3,(H2,21,25) |
| InChIKey | OPQCDQIOQOVKAW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |