C23H26N4O4 — CID 17483169
2-(3-methylbutyl)-N-(6-morpholin-4-yl-3-pyridinyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 17483169) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-(3-methylbutyl)-N-(6-morpholin-4-yl-3-pyridinyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(3-methylbutyl)-N-(6-morpholin-4-yl-3-pyridinyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 17483169 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-(3-methylbutyl)-N-(6-morpholin-4-yl-3-pyridinyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CC(C)CCN1C(=O)c2ccc(C(=O)Nc3ccc(N4CCOCC4)nc3)cc2C1=O |
| InChI | InChI=1S/C23H26N4O4/c1-15(2)7-8-27-22(29)18-5-3-16(13-19(18)23(27)30)21(28)25-17-4-6-20(24-14-17)26-9-11-31-12-10-26/h3-6,13-15H,7-12H2,1-2H3,(H,25,28) |
| InChIKey | CRINUOLUAGAMHG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|