C23H22N4O4 — CID 17341640
2-(3-methylbutyl)-1,3-dioxo-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)isoindole-5-carboxamide (PubChem CID 17341640) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 2-(3-methylbutyl)-1,3-dioxo-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)isoindole-5-carboxamide.
| Compound Name | 2-(3-methylbutyl)-1,3-dioxo-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 17341640 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-(3-methylbutyl)-1,3-dioxo-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)isoindole-5-carboxamide |
| SMILES | CC(C)CCN1C(=O)c2ccc(C(=O)NC3=NN(c4ccccc4)C(=O)C3)cc2C1=O |
| InChI | InChI=1S/C23H22N4O4/c1-14(2)10-11-26-22(30)17-9-8-15(12-18(17)23(26)31)21(29)24-19-13-20(28)27(25-19)16-6-4-3-5-7-16/h3-9,12,14H,10-11,13H2,1-2H3,(H,24,25,29) |
| InChIKey | MDWSVXABFULITH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|