C20H16N4O4 — CID 17341637
2-ethyl-1,3-dioxo-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)isoindole-5-carboxamide (PubChem CID 17341637) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is 2-ethyl-1,3-dioxo-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)isoindole-5-carboxamide.
| Compound Name | 2-ethyl-1,3-dioxo-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 17341637 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-ethyl-1,3-dioxo-N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)isoindole-5-carboxamide |
| SMILES | CCN1C(=O)c2ccc(C(=O)NC3=NN(c4ccccc4)C(=O)C3)cc2C1=O |
| InChI | InChI=1S/C20H16N4O4/c1-2-23-19(27)14-9-8-12(10-15(14)20(23)28)18(26)21-16-11-17(25)24(22-16)13-6-4-3-5-7-13/h3-10H,2,11H2,1H3,(H,21,22,26) |
| InChIKey | IUFUQFDJWJRRCC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|