C19H12N2O7-2 — CID 3511151
5-[(2-ethyl-1,3-dioxoisoindole-5-carbonyl)amino]benzene-1,3-dicarboxylate (PubChem CID 3511151) has the molecular formula C19H12N2O7-2 and a molecular weight of 380.31 g/mol. Its IUPAC name is 5-[(2-ethyl-1,3-dioxoisoindole-5-carbonyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | 5-[(2-ethyl-1,3-dioxoisoindole-5-carbonyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3511151 |
| Molecular Formula | C19H12N2O7-2 |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 5-[(2-ethyl-1,3-dioxoisoindole-5-carbonyl)amino]benzene-1,3-dicarboxylate |
| SMILES | CCN1C(=O)c2ccc(C(=O)Nc3cc(C(=O)[O-])cc(C(=O)[O-])c3)cc2C1=O |
| InChI | InChI=1S/C19H14N2O7/c1-2-21-16(23)13-4-3-9(8-14(13)17(21)24)15(22)20-12-6-10(18(25)26)5-11(7-12)19(27)28/h3-8H,2H2,1H3,(H,20,22)(H,25,26)(H,27,28)/p-2 |
| InChIKey | UFCNZSGZPPABQD-UHFFFAOYSA-L |
| XLogP | -0.72 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|