C12H14N4O2 — CID 131879882
1-ethyl-3-(5-oxo-1-phenyl-4H-pyrazol-3-yl)urea (PubChem CID 131879882) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-ethyl-3-(5-oxo-1-phenyl-4H-pyrazol-3-yl)urea.
| Compound Name | 1-ethyl-3-(5-oxo-1-phenyl-4H-pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 131879882 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-ethyl-3-(5-oxo-1-phenyl-4H-pyrazol-3-yl)urea |
| SMILES | CCNC(=O)NC1=NN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C12H14N4O2/c1-2-13-12(18)14-10-8-11(17)16(15-10)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H2,13,14,15,18) |
| InChIKey | AFYXATUJOKVWTB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'} |
|---|