C23H19N3O2 — CID 17341544
N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-2,2-diphenylacetamide (PubChem CID 17341544) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-2,2-diphenylacetamide.
| Compound Name | N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 17341544 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-2,2-diphenylacetamide |
| SMILES | O=C(NC1=NN(c2ccccc2)C(=O)C1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O2/c27-21-16-20(25-26(21)19-14-8-3-9-15-19)24-23(28)22(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-15,22H,16H2,(H,24,25,28) |
| InChIKey | GHNYBNAFNGBZSL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'} |
|---|