C25H29N3O3 — CID 2409938
2-(3-methylbutyl)-1,3-dioxo-N-(2-piperidin-1-ylphenyl)isoindole-5-carboxamide (PubChem CID 2409938) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-(3-methylbutyl)-1,3-dioxo-N-(2-piperidin-1-ylphenyl)isoindole-5-carboxamide.
| Compound Name | 2-(3-methylbutyl)-1,3-dioxo-N-(2-piperidin-1-ylphenyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 2409938 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-(3-methylbutyl)-1,3-dioxo-N-(2-piperidin-1-ylphenyl)isoindole-5-carboxamide |
| SMILES | CC(C)CCN1C(=O)c2ccc(C(=O)Nc3ccccc3N3CCCCC3)cc2C1=O |
| InChI | InChI=1S/C25H29N3O3/c1-17(2)12-15-28-24(30)19-11-10-18(16-20(19)25(28)31)23(29)26-21-8-4-5-9-22(21)27-13-6-3-7-14-27/h4-5,8-11,16-17H,3,6-7,12-15H2,1-2H3,(H,26,29) |
| InChIKey | NVKKNWONMYIRPO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|