C20H24N4O2 — CID 119514987
N-(6-amino-3-pyridinyl)-1-(3-phenylpropanoyl)piperidine-4-carboxamide (PubChem CID 119514987) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-1-(3-phenylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-(6-amino-3-pyridinyl)-1-(3-phenylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119514987 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-1-(3-phenylpropanoyl)piperidine-4-carboxamide |
| SMILES | Nc1ccc(NC(=O)C2CCN(C(=O)CCc3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C20H24N4O2/c21-18-8-7-17(14-22-18)23-20(26)16-10-12-24(13-11-16)19(25)9-6-15-4-2-1-3-5-15/h1-5,7-8,14,16H,6,9-13H2,(H2,21,22)(H,23,26) |
| InChIKey | BYUCKSMWBKDQGA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |