C18H20FN5O3 — CID 59198222
N-[3-[(5-fluoro-2-pyridinyl)amino]-4-nitrophenyl]-1-methylpiperidine-4-carboxamide (PubChem CID 59198222) has the molecular formula C18H20FN5O3 and a molecular weight of 373.39 g/mol. Its IUPAC name is N-[3-[(5-fluoro-2-pyridinyl)amino]-4-nitrophenyl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[3-[(5-fluoro-2-pyridinyl)amino]-4-nitrophenyl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 59198222 |
| Molecular Formula | C18H20FN5O3 |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[3-[(5-fluoro-2-pyridinyl)amino]-4-nitrophenyl]-1-methylpiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)Nc2ccc([N+](=O)[O-])c(Nc3ccc(F)cn3)c2)CC1 |
| InChI | InChI=1S/C18H20FN5O3/c1-23-8-6-12(7-9-23)18(25)21-14-3-4-16(24(26)27)15(10-14)22-17-5-2-13(19)11-20-17/h2-5,10-12H,6-9H2,1H3,(H,20,22)(H,21,25) |
| InChIKey | OLLXASSXNIQJMP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|