C20H22BrN5O4 — CID 55816601
N-(5-bromo-2-pyridinyl)-1-[2-(4-methyl-3-nitroanilino)-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 55816601) has the molecular formula C20H22BrN5O4 and a molecular weight of 476.33 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-1-[2-(4-methyl-3-nitroanilino)-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-1-[2-(4-methyl-3-nitroanilino)-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55816601 |
| Molecular Formula | C20H22BrN5O4 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-1-[2-(4-methyl-3-nitroanilino)-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)CN2CCC(C(=O)Nc3ccc(Br)cn3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22BrN5O4/c1-13-2-4-16(10-17(13)26(29)30)23-19(27)12-25-8-6-14(7-9-25)20(28)24-18-5-3-15(21)11-22-18/h2-5,10-11,14H,6-9,12H2,1H3,(H,23,27)(H,22,24,28) |
| InChIKey | AZBLIKVHZDDHSU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|