C19H23N5O3 — CID 34727808
N-(4-methyl-3-nitrophenyl)-2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]acetamide (PubChem CID 34727808) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is N-(4-methyl-3-nitrophenyl)-2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-methyl-3-nitrophenyl)-2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 34727808 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-(4-methyl-3-nitrophenyl)-2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCN(Cc3ccccn3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H23N5O3/c1-15-5-6-16(12-18(15)24(26)27)21-19(25)14-23-10-8-22(9-11-23)13-17-4-2-3-7-20-17/h2-7,12H,8-11,13-14H2,1H3,(H,21,25) |
| InChIKey | HJEOGCKGHFQAJT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|