C14H16F3N3O2 — CID 122430198
7-methyl-2-[4-nitro-3-(trifluoromethyl)phenyl]-2,7-diazaspiro[3.4]octane (PubChem CID 122430198) has the molecular formula C14H16F3N3O2 and a molecular weight of 315.30 g/mol. Its IUPAC name is 7-methyl-2-[4-nitro-3-(trifluoromethyl)phenyl]-2,7-diazaspiro[3.4]octane.
| Compound Name | 7-methyl-2-[4-nitro-3-(trifluoromethyl)phenyl]-2,7-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 122430198 |
| Molecular Formula | C14H16F3N3O2 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 7-methyl-2-[4-nitro-3-(trifluoromethyl)phenyl]-2,7-diazaspiro[3.4]octane |
| SMILES | CN1CCC2(C1)CN(c1ccc([N+](=O)[O-])c(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C14H16F3N3O2/c1-18-5-4-13(7-18)8-19(9-13)10-2-3-12(20(21)22)11(6-10)14(15,16)17/h2-3,6H,4-5,7-9H2,1H3 |
| InChIKey | FIGZZCPHZXRCJP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|