C17H22F3N3O2 — CID 133341418
3-[4-nitro-3-(trifluoromethyl)phenyl]-9-propan-2-yl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 133341418) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is 3-[4-nitro-3-(trifluoromethyl)phenyl]-9-propan-2-yl-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-[4-nitro-3-(trifluoromethyl)phenyl]-9-propan-2-yl-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 133341418 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-[4-nitro-3-(trifluoromethyl)phenyl]-9-propan-2-yl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | CC(C)N1C2CCC1CN(c1ccc([N+](=O)[O-])c(C(F)(F)F)c1)CC2 |
| InChI | InChI=1S/C17H22F3N3O2/c1-11(2)22-12-3-4-14(22)10-21(8-7-12)13-5-6-16(23(24)25)15(9-13)17(18,19)20/h5-6,9,11-12,14H,3-4,7-8,10H2,1-2H3 |
| InChIKey | HJZQKOKEQXMGAX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|