C14H14F3N5O2 — CID 133455677
1-[4-nitro-3-(trifluoromethyl)phenyl]-4-(triazol-1-yl)piperidine (PubChem CID 133455677) has the molecular formula C14H14F3N5O2 and a molecular weight of 341.29 g/mol. Its IUPAC name is 1-[4-nitro-3-(trifluoromethyl)phenyl]-4-(triazol-1-yl)piperidine.
| Compound Name | 1-[4-nitro-3-(trifluoromethyl)phenyl]-4-(triazol-1-yl)piperidine |
|---|---|
| PubChem CID | 133455677 |
| Molecular Formula | C14H14F3N5O2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 1-[4-nitro-3-(trifluoromethyl)phenyl]-4-(triazol-1-yl)piperidine |
| SMILES | O=[N+]([O-])c1ccc(N2CCC(n3ccnn3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H14F3N5O2/c15-14(16,17)12-9-11(1-2-13(12)22(23)24)20-6-3-10(4-7-20)21-8-5-18-19-21/h1-2,5,8-10H,3-4,6-7H2 |
| InChIKey | HESWLEAYFZYSMY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|