C26H22Cl2N4O2S — CID 123625652
3-(3-chloro-4-isocyanophenyl)-1-[3-(2-chloro-4-pyridin-4-ylphenoxy)propyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 123625652) has the molecular formula C26H22Cl2N4O2S and a molecular weight of 525.46 g/mol. Its IUPAC name is 3-(3-chloro-4-isocyanophenyl)-1-[3-(2-chloro-4-pyridin-4-ylphenoxy)propyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-(3-chloro-4-isocyanophenyl)-1-[3-(2-chloro-4-pyridin-4-ylphenoxy)propyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 123625652 |
| Molecular Formula | C26H22Cl2N4O2S |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | 3-(3-chloro-4-isocyanophenyl)-1-[3-(2-chloro-4-pyridin-4-ylphenoxy)propyl]-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(CCCOc3ccc(-c4ccncc4)cc3Cl)C2=S)cc1Cl |
| InChI | InChI=1S/C26H22Cl2N4O2S/c1-26(2)24(33)32(19-6-7-22(29-3)20(27)16-19)25(35)31(26)13-4-14-34-23-8-5-18(15-21(23)28)17-9-11-30-12-10-17/h5-12,15-16H,4,13-14H2,1-2H3 |
| InChIKey | BCJISLFCLAGYOL-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 50.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|