C36H17F3N4O2S — CID 159426474
hexadeca-2,4,6,8,10,12,14-heptaynenitrile;5-(4-hydroxyphenyl)-7-[4-isocyano-3-(trifluoromethyl)phenyl]-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one (PubChem CID 159426474) has the molecular formula C36H17F3N4O2S and a molecular weight of 626.62 g/mol. Its IUPAC name is hexadeca-2,4,6,8,10,12,14-heptaynenitrile;5-(4-hydroxyphenyl)-7-[4-isocyano-3-(trifluoromethyl)phenyl]-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one.
| Compound Name | hexadeca-2,4,6,8,10,12,14-heptaynenitrile;5-(4-hydroxyphenyl)-7-[4-isocyano-3-(trifluoromethyl)phenyl]-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one |
|---|---|
| PubChem CID | 159426474 |
| Molecular Formula | C36H17F3N4O2S |
| Molecular Weight | 626.62 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | hexadeca-2,4,6,8,10,12,14-heptaynenitrile;5-(4-hydroxyphenyl)-7-[4-isocyano-3-(trifluoromethyl)phenyl]-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC#N.[C-]#[N+]c1ccc(N2C(=O)C3(CCC3)N(c3ccc(O)cc3)C2=S)cc1C(F)(F)F |
| InChI | InChI=1S/C20H14F3N3O2S.C16H3N/c1-24-16-8-5-13(11-15(16)20(21,22)23)25-17(28)19(9-2-10-19)26(18(25)29)12-3-6-14(27)7-4-12;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17/h3-8,11,27H,2,9-10H2;1H3 |
| InChIKey | LQKNWIONALRPBX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|