C23H22F3N5S2 — CID 73204931
1-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-(4-methylphenyl)-2-sulfanylideneimidazolidin-4-ylidene]-3-ethylthiourea (PubChem CID 73204931) has the molecular formula C23H22F3N5S2 and a molecular weight of 489.59 g/mol. Its IUPAC name is 1-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-(4-methylphenyl)-2-sulfanylideneimidazolidin-4-ylidene]-3-ethylthiourea.
| Compound Name | 1-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-(4-methylphenyl)-2-sulfanylideneimidazolidin-4-ylidene]-3-ethylthiourea |
|---|---|
| PubChem CID | 73204931 |
| Molecular Formula | C23H22F3N5S2 |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 1-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-1-(4-methylphenyl)-2-sulfanylideneimidazolidin-4-ylidene]-3-ethylthiourea |
| SMILES | CCNC(=S)N=C1N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N(c2ccc(C)cc2)C1(C)C |
| InChI | InChI=1S/C23H22F3N5S2/c1-5-28-20(32)29-19-22(3,4)31(16-9-6-14(2)7-10-16)21(33)30(19)17-11-8-15(13-27)18(12-17)23(24,25)26/h6-12H,5H2,1-4H3,(H,28,32) |
| InChIKey | KKBFFFLFMQHVDE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 54.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|