C23H22Cl2N4O2 — CID 23588312
4-[3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-7-propyl-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile (PubChem CID 23588312) has the molecular formula C23H22Cl2N4O2 and a molecular weight of 457.36 g/mol. Its IUPAC name is 4-[3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-7-propyl-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile.
| Compound Name | 4-[3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-7-propyl-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile |
|---|---|
| PubChem CID | 23588312 |
| Molecular Formula | C23H22Cl2N4O2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 4-[3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-7-propyl-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile |
| SMILES | CCCN1CC(c2ccc(C#N)cc2)C2(C1)C(=O)N(c1cc(Cl)cc(Cl)c1)C(=O)N2C |
| InChI | InChI=1S/C23H22Cl2N4O2/c1-3-8-28-13-20(16-6-4-15(12-26)5-7-16)23(14-28)21(30)29(22(31)27(23)2)19-10-17(24)9-18(25)11-19/h4-7,9-11,20H,3,8,13-14H2,1-2H3 |
| InChIKey | RIKYDSOPIRXFNY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 67.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|