C26H20Cl2N4O4S — CID 90924634
2-[[(5S,9S)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]methyl]thiophene-3-carboxylic acid (PubChem CID 90924634) has the molecular formula C26H20Cl2N4O4S and a molecular weight of 555.44 g/mol. Its IUPAC name is 2-[[(5S,9S)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]methyl]thiophene-3-carboxylic acid.
| Compound Name | 2-[[(5S,9S)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]methyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 90924634 |
| Molecular Formula | C26H20Cl2N4O4S |
| Molecular Weight | 555.44 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | 2-[[(5S,9S)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]methyl]thiophene-3-carboxylic acid |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@]12CN(Cc1sccc1C(=O)O)C[C@@H]2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H20Cl2N4O4S/c1-30-25(36)32(19-9-17(27)8-18(28)10-19)24(35)26(30)14-31(13-22-20(23(33)34)6-7-37-22)12-21(26)16-4-2-15(11-29)3-5-16/h2-10,21H,12-14H2,1H3,(H,33,34)/t21-,26-/m1/s1 |
| InChIKey | LNMFKQXVJRCLNV-QFQXNSOFSA-N |
| XLogP | 5.06 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|