C27H22Cl2N4O2 — CID 23588325
4-[7-benzyl-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile (PubChem CID 23588325) has the molecular formula C27H22Cl2N4O2 and a molecular weight of 505.41 g/mol. Its IUPAC name is 4-[7-benzyl-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile.
| Compound Name | 4-[7-benzyl-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile |
|---|---|
| PubChem CID | 23588325 |
| Molecular Formula | C27H22Cl2N4O2 |
| Molecular Weight | 505.41 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 4-[7-benzyl-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)C12CN(Cc1ccccc1)CC2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H22Cl2N4O2/c1-31-26(35)33(23-12-21(28)11-22(29)13-23)25(34)27(31)17-32(15-19-5-3-2-4-6-19)16-24(27)20-9-7-18(14-30)8-10-20/h2-13,24H,15-17H2,1H3 |
| InChIKey | XYVGXDQZIPFLPB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 67.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|