C31H29Cl2N5O3 — CID 91014562
4-[(5S,9S)-3-(3,5-dichlorophenyl)-1-methyl-7-[(2-morpholin-4-ylphenyl)methyl]-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile (PubChem CID 91014562) has the molecular formula C31H29Cl2N5O3 and a molecular weight of 590.51 g/mol. Its IUPAC name is 4-[(5S,9S)-3-(3,5-dichlorophenyl)-1-methyl-7-[(2-morpholin-4-ylphenyl)methyl]-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile.
| Compound Name | 4-[(5S,9S)-3-(3,5-dichlorophenyl)-1-methyl-7-[(2-morpholin-4-ylphenyl)methyl]-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile |
|---|---|
| PubChem CID | 91014562 |
| Molecular Formula | C31H29Cl2N5O3 |
| Molecular Weight | 590.51 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | 4-[(5S,9S)-3-(3,5-dichlorophenyl)-1-methyl-7-[(2-morpholin-4-ylphenyl)methyl]-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@]12CN(Cc1ccccc1N1CCOCC1)C[C@@H]2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C31H29Cl2N5O3/c1-35-30(40)38(26-15-24(32)14-25(33)16-26)29(39)31(35)20-36(19-27(31)22-8-6-21(17-34)7-9-22)18-23-4-2-3-5-28(23)37-10-12-41-13-11-37/h2-9,14-16,27H,10-13,18-20H2,1H3/t27-,31-/m1/s1 |
| InChIKey | UCNKPZOJHFFDDJ-DLFZDVPBSA-N |
| XLogP | 5.14 |
| TPSA | 80.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|