C26H20Cl3N5O2 — CID 23588289
4-[7-[(2-chloro-3-pyridinyl)methyl]-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile (PubChem CID 23588289) has the molecular formula C26H20Cl3N5O2 and a molecular weight of 540.84 g/mol. Its IUPAC name is 4-[7-[(2-chloro-3-pyridinyl)methyl]-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile.
| Compound Name | 4-[7-[(2-chloro-3-pyridinyl)methyl]-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile |
|---|---|
| PubChem CID | 23588289 |
| Molecular Formula | C26H20Cl3N5O2 |
| Molecular Weight | 540.84 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 4-[7-[(2-chloro-3-pyridinyl)methyl]-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)C12CN(Cc1cccnc1Cl)CC2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H20Cl3N5O2/c1-32-25(36)34(21-10-19(27)9-20(28)11-21)24(35)26(32)15-33(13-18-3-2-8-31-23(18)29)14-22(26)17-6-4-16(12-30)5-7-17/h2-11,22H,13-15H2,1H3 |
| InChIKey | DTWGPAALNZIHKC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 80.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.84 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|