C28H23Cl2N5O6 — CID 58666342
5-carboxy-2-[[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]methyl]-N-hydroxybenzeneamine oxide (PubChem CID 58666342) has the molecular formula C28H23Cl2N5O6 and a molecular weight of 596.43 g/mol. Its IUPAC name is 5-carboxy-2-[[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]methyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 5-carboxy-2-[[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]methyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 58666342 |
| Molecular Formula | C28H23Cl2N5O6 |
| Molecular Weight | 596.43 g/mol |
| Exact Mass | 595.10 |
| IUPAC Name | 5-carboxy-2-[[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]methyl]-N-hydroxybenzeneamine oxide |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@]12CN(Cc1ccc(C(=O)O)cc1[NH+]([O-])O)C[C@H]2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C28H23Cl2N5O6/c1-32-27(39)34(22-10-20(29)9-21(30)11-22)26(38)28(32)15-33(14-23(28)17-4-2-16(12-31)3-5-17)13-19-7-6-18(25(36)37)8-24(19)35(40)41/h2-11,23,35,40H,13-15H2,1H3,(H,36,37)/t23-,28+/m0/s1 |
| InChIKey | XDGPDCDOWITVNZ-NEKDWFFYSA-N |
| XLogP | 3.40 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|