C25H18Cl2N6O4 — CID 46220742
2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]pyrimidine-5-carboxylic acid (PubChem CID 46220742) has the molecular formula C25H18Cl2N6O4 and a molecular weight of 537.36 g/mol. Its IUPAC name is 2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]pyrimidine-5-carboxylic acid.
| Compound Name | 2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 46220742 |
| Molecular Formula | C25H18Cl2N6O4 |
| Molecular Weight | 537.36 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | 2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]pyrimidine-5-carboxylic acid |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@]12CN(c1ncc(C(=O)O)cn1)C[C@H]2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C25H18Cl2N6O4/c1-31-24(37)33(19-7-17(26)6-18(27)8-19)22(36)25(31)13-32(23-29-10-16(11-30-23)21(34)35)12-20(25)15-4-2-14(9-28)3-5-15/h2-8,10-11,20H,12-13H2,1H3,(H,34,35)/t20-,25+/m0/s1 |
| InChIKey | BOERNFAHPQKHIM-NBGIEHNGSA-N |
| XLogP | 3.79 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|