C24H17Cl2N5O4S — CID 46220964
2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]-1,3-thiazole-5-carboxylic acid (PubChem CID 46220964) has the molecular formula C24H17Cl2N5O4S and a molecular weight of 542.40 g/mol. Its IUPAC name is 2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 46220964 |
| Molecular Formula | C24H17Cl2N5O4S |
| Molecular Weight | 542.40 g/mol |
| Exact Mass | 541.04 |
| IUPAC Name | 2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]-1,3-thiazole-5-carboxylic acid |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@]12CN(c1ncc(C(=O)O)s1)C[C@H]2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C24H17Cl2N5O4S/c1-29-23(35)31(17-7-15(25)6-16(26)8-17)21(34)24(29)12-30(22-28-10-19(36-22)20(32)33)11-18(24)14-4-2-13(9-27)3-5-14/h2-8,10,18H,11-12H2,1H3,(H,32,33)/t18-,24+/m0/s1 |
| InChIKey | BFZWHXBQAYWTFR-MHECFPHRSA-N |
| XLogP | 4.46 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|