C27H22Cl2N6O4 — CID 46221419
ethyl 2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]pyrimidine-5-carboxylate (PubChem CID 46221419) has the molecular formula C27H22Cl2N6O4 and a molecular weight of 565.42 g/mol. Its IUPAC name is ethyl 2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 46221419 |
| Molecular Formula | C27H22Cl2N6O4 |
| Molecular Weight | 565.42 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | ethyl 2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2C[C@@H](c3ccc(C#N)cc3)[C@]3(C2)C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)N3C)nc1 |
| InChI | InChI=1S/C27H22Cl2N6O4/c1-3-39-23(36)18-12-31-25(32-13-18)34-14-22(17-6-4-16(11-30)5-7-17)27(15-34)24(37)35(26(38)33(27)2)21-9-19(28)8-20(29)10-21/h4-10,12-13,22H,3,14-15H2,1-2H3/t22-,27+/m0/s1 |
| InChIKey | USTZBDZLVTZUIH-WXVAWEFUSA-N |
| XLogP | 4.27 |
| TPSA | 119.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|