C28H31Cl2N5O3 — CID 163535748
4-[(9R)-7-(8-aminooctanoyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile (PubChem CID 163535748) has the molecular formula C28H31Cl2N5O3 and a molecular weight of 556.49 g/mol. Its IUPAC name is 4-[(9R)-7-(8-aminooctanoyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile.
| Compound Name | 4-[(9R)-7-(8-aminooctanoyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile |
|---|---|
| PubChem CID | 163535748 |
| Molecular Formula | C28H31Cl2N5O3 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 4-[(9R)-7-(8-aminooctanoyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)C12CN(C(=O)CCCCCCCN)C[C@H]2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C28H31Cl2N5O3/c1-33-27(38)35(23-14-21(29)13-22(30)15-23)26(37)28(33)18-34(25(36)7-5-3-2-4-6-12-31)17-24(28)20-10-8-19(16-32)9-11-20/h8-11,13-15,24H,2-7,12,17-18,31H2,1H3/t24-,28?/m0/s1 |
| InChIKey | DWUUNCDWTUNAJE-ZZDYIDRTSA-N |
| XLogP | 4.93 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|