C28H21Cl2N5O3 — CID 91319890
4-[(5S,9R)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-7-(3-pyridin-3-ylprop-2-enoyl)-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile (PubChem CID 91319890) has the molecular formula C28H21Cl2N5O3 and a molecular weight of 546.41 g/mol. Its IUPAC name is 4-[(5S,9R)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-7-(3-pyridin-3-ylprop-2-enoyl)-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile.
| Compound Name | 4-[(5S,9R)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-7-(3-pyridin-3-ylprop-2-enoyl)-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile |
|---|---|
| PubChem CID | 91319890 |
| Molecular Formula | C28H21Cl2N5O3 |
| Molecular Weight | 546.41 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | 4-[(5S,9R)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-7-(3-pyridin-3-ylprop-2-enoyl)-1,3,7-triazaspiro[4.4]nonan-9-yl]benzonitrile |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@]12CN(C(=O)C=Cc1cccnc1)C[C@H]2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C28H21Cl2N5O3/c1-33-27(38)35(23-12-21(29)11-22(30)13-23)26(37)28(33)17-34(25(36)9-6-19-3-2-10-32-15-19)16-24(28)20-7-4-18(14-31)5-8-20/h2-13,15,24H,16-17H2,1H3/t24-,28+/m0/s1 |
| InChIKey | BOQXIAKASNVWGG-RBJSKKJNSA-N |
| XLogP | 4.74 |
| TPSA | 97.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|