C28H24Cl2N6O4 — CID 158796410
N-[2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]-2-oxoethyl]pyridine-3-carboxamide;molecular hydrogen (PubChem CID 158796410) has the molecular formula C28H24Cl2N6O4 and a molecular weight of 579.44 g/mol. Its IUPAC name is N-[2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]-2-oxoethyl]pyridine-3-carboxamide;molecular hydrogen.
| Compound Name | N-[2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]-2-oxoethyl]pyridine-3-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 158796410 |
| Molecular Formula | C28H24Cl2N6O4 |
| Molecular Weight | 579.44 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | N-[2-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]-2-oxoethyl]pyridine-3-carboxamide;molecular hydrogen |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@]12CN(C(=O)CNC(=O)c1cccnc1)C[C@H]2c1ccc(C#N)cc1.[H][H] |
| InChI | InChI=1S/C28H22Cl2N6O4.H2/c1-34-27(40)36(22-10-20(29)9-21(30)11-22)26(39)28(34)16-35(15-23(28)18-6-4-17(12-31)5-7-18)24(37)14-33-25(38)19-3-2-8-32-13-19;/h2-11,13,23H,14-16H2,1H3,(H,33,38);1H/t23-,28+;/m0./s1 |
| InChIKey | ISXKPWKUKRPIKD-QEWYMDETSA-N |
| XLogP | 3.70 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|