C27H30Cl2N5O3+ — CID 58666327
[4-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]-4-oxobutyl]-trimethylazanium (PubChem CID 58666327) has the molecular formula C27H30Cl2N5O3+ and a molecular weight of 543.48 g/mol. Its IUPAC name is [4-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]-4-oxobutyl]-trimethylazanium.
| Compound Name | [4-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]-4-oxobutyl]-trimethylazanium |
|---|---|
| PubChem CID | 58666327 |
| Molecular Formula | C27H30Cl2N5O3+ |
| Molecular Weight | 543.48 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | [4-[(5S,9R)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]-4-oxobutyl]-trimethylazanium |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@]12CN(C(=O)CCC[N+](C)(C)C)C[C@H]2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H30Cl2N5O3/c1-31-26(37)33(22-13-20(28)12-21(29)14-22)25(36)27(31)17-32(24(35)6-5-11-34(2,3)4)16-23(27)19-9-7-18(15-30)8-10-19/h7-10,12-14,23H,5-6,11,16-17H2,1-4H3/q+1/t23-,27+/m0/s1 |
| InChIKey | QOOVJWMFJLNRAI-WNCULLNHSA-N |
| XLogP | 4.11 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|