C30H27Cl2N5O4 — CID 90811460
tert-butyl 6-[(5S,9S)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]pyridine-3-carboxylate (PubChem CID 90811460) has the molecular formula C30H27Cl2N5O4 and a molecular weight of 592.48 g/mol. Its IUPAC name is tert-butyl 6-[(5S,9S)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]pyridine-3-carboxylate.
| Compound Name | tert-butyl 6-[(5S,9S)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 90811460 |
| Molecular Formula | C30H27Cl2N5O4 |
| Molecular Weight | 592.48 g/mol |
| Exact Mass | 591.14 |
| IUPAC Name | tert-butyl 6-[(5S,9S)-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-1-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl]pyridine-3-carboxylate |
| SMILES | CN1C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)[C@]12CN(c1ccc(C(=O)OC(C)(C)C)cn1)C[C@@H]2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C30H27Cl2N5O4/c1-29(2,3)41-26(38)20-9-10-25(34-15-20)36-16-24(19-7-5-18(14-33)6-8-19)30(17-36)27(39)37(28(40)35(30)4)23-12-21(31)11-22(32)13-23/h5-13,15,24H,16-17H2,1-4H3/t24-,30-/m1/s1 |
| InChIKey | LFCFGGQZCQYQQM-AYWVHJORSA-N |
| XLogP | 5.66 |
| TPSA | 106.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|