C30H26Cl2N4O4 — CID 23588261
4-[7-benzyl-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-1-yl]butanoic acid (PubChem CID 23588261) has the molecular formula C30H26Cl2N4O4 and a molecular weight of 577.47 g/mol. Its IUPAC name is 4-[7-benzyl-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-1-yl]butanoic acid.
| Compound Name | 4-[7-benzyl-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-1-yl]butanoic acid |
|---|---|
| PubChem CID | 23588261 |
| Molecular Formula | C30H26Cl2N4O4 |
| Molecular Weight | 577.47 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | 4-[7-benzyl-9-(4-cyanophenyl)-3-(3,5-dichlorophenyl)-2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-1-yl]butanoic acid |
| SMILES | N#Cc1ccc(C2CN(Cc3ccccc3)CC23C(=O)N(c2cc(Cl)cc(Cl)c2)C(=O)N3CCCC(=O)O)cc1 |
| InChI | InChI=1S/C30H26Cl2N4O4/c31-23-13-24(32)15-25(14-23)36-28(39)30(35(29(36)40)12-4-7-27(37)38)19-34(17-21-5-2-1-3-6-21)18-26(30)22-10-8-20(16-33)9-11-22/h1-3,5-6,8-11,13-15,26H,4,7,12,17-19H2,(H,37,38) |
| InChIKey | NHBHKSYEGSBGMY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|