C17H25BrN2O4S — CID 78872388
1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-3-(2-methylpropoxy)propan-1-one (PubChem CID 78872388) has the molecular formula C17H25BrN2O4S and a molecular weight of 433.37 g/mol. Its IUPAC name is 1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-3-(2-methylpropoxy)propan-1-one.
| Compound Name | 1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-3-(2-methylpropoxy)propan-1-one |
|---|---|
| PubChem CID | 78872388 |
| Molecular Formula | C17H25BrN2O4S |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-3-(2-methylpropoxy)propan-1-one |
| SMILES | CC(C)COCCC(=O)N1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C17H25BrN2O4S/c1-14(2)13-24-12-7-17(21)19-8-10-20(11-9-19)25(22,23)16-5-3-15(18)4-6-16/h3-6,14H,7-13H2,1-2H3 |
| InChIKey | DUHTUANFCIAGFX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|