C19H23N3O3S — CID 100568567
methyl 2-[4-[[4-(furan-2-ylmethyl)piperazine-1-carbothioyl]amino]phenyl]acetate (PubChem CID 100568567) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is methyl 2-[4-[[4-(furan-2-ylmethyl)piperazine-1-carbothioyl]amino]phenyl]acetate.
| Compound Name | methyl 2-[4-[[4-(furan-2-ylmethyl)piperazine-1-carbothioyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 100568567 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | methyl 2-[4-[[4-(furan-2-ylmethyl)piperazine-1-carbothioyl]amino]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(NC(=S)N2CCN(Cc3ccco3)CC2)cc1 |
| InChI | InChI=1S/C19H23N3O3S/c1-24-18(23)13-15-4-6-16(7-5-15)20-19(26)22-10-8-21(9-11-22)14-17-3-2-12-25-17/h2-7,12H,8-11,13-14H2,1H3,(H,20,26) |
| InChIKey | HHHNABLJQSNGPW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|