C21H28N4O4 — CID 86892866
tert-butyl N-[4-[[4-(furan-2-ylmethyl)piperazine-1-carbonyl]amino]phenyl]carbamate (PubChem CID 86892866) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-(furan-2-ylmethyl)piperazine-1-carbonyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[4-(furan-2-ylmethyl)piperazine-1-carbonyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 86892866 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | tert-butyl N-[4-[[4-(furan-2-ylmethyl)piperazine-1-carbonyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(NC(=O)N2CCN(Cc3ccco3)CC2)cc1 |
| InChI | InChI=1S/C21H28N4O4/c1-21(2,3)29-20(27)23-17-8-6-16(7-9-17)22-19(26)25-12-10-24(11-13-25)15-18-5-4-14-28-18/h4-9,14H,10-13,15H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | QWBUJWSAUMQBPG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |