C18H23N3O2 — CID 113106397
N-(2,3-dimethylphenyl)-4-(furan-2-ylmethyl)piperazine-1-carboxamide (PubChem CID 113106397) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-4-(furan-2-ylmethyl)piperazine-1-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-4-(furan-2-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113106397 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-(2,3-dimethylphenyl)-4-(furan-2-ylmethyl)piperazine-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCN(Cc3ccco3)CC2)c1C |
| InChI | InChI=1S/C18H23N3O2/c1-14-5-3-7-17(15(14)2)19-18(22)21-10-8-20(9-11-21)13-16-6-4-12-23-16/h3-7,12H,8-11,13H2,1-2H3,(H,19,22) |
| InChIKey | BZHQBQUZYWOFPK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |