C19H24ClN3O2 — CID 30740476
(2S)-N-(3-chloro-2-methylphenyl)-2-[4-(furan-2-ylmethyl)piperazin-1-yl]propanamide (PubChem CID 30740476) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is (2S)-N-(3-chloro-2-methylphenyl)-2-[4-(furan-2-ylmethyl)piperazin-1-yl]propanamide.
| Compound Name | (2S)-N-(3-chloro-2-methylphenyl)-2-[4-(furan-2-ylmethyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 30740476 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (2S)-N-(3-chloro-2-methylphenyl)-2-[4-(furan-2-ylmethyl)piperazin-1-yl]propanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)[C@H](C)N1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C19H24ClN3O2/c1-14-17(20)6-3-7-18(14)21-19(24)15(2)23-10-8-22(9-11-23)13-16-5-4-12-25-16/h3-7,12,15H,8-11,13H2,1-2H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | PBEFNWTUACHYMV-HNNXBMFYSA-N |
| XLogP | 3.39 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |