C19H24ClN3OS — CID 30724631
(2R)-N-(3-chloro-2-methylphenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propanamide (PubChem CID 30724631) has the molecular formula C19H24ClN3OS and a molecular weight of 377.94 g/mol. Its IUPAC name is (2R)-N-(3-chloro-2-methylphenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-(3-chloro-2-methylphenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 30724631 |
| Molecular Formula | C19H24ClN3OS |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (2R)-N-(3-chloro-2-methylphenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)[C@@H](C)N1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C19H24ClN3OS/c1-14-17(20)4-3-5-18(14)21-19(24)15(2)23-9-7-22(8-10-23)12-16-6-11-25-13-16/h3-6,11,13,15H,7-10,12H2,1-2H3,(H,21,24)/t15-/m1/s1 |
| InChIKey | NCZTUIHOJMQLLJ-OAHLLOKOSA-N |
| XLogP | 3.85 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |