C22H25ClFN3O2 — CID 55682346
N-(3-chloro-2-methylphenyl)-2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]propanamide (PubChem CID 55682346) has the molecular formula C22H25ClFN3O2 and a molecular weight of 417.91 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]propanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 55682346 |
| Molecular Formula | C22H25ClFN3O2 |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]propanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(C)N1CCN(C(=O)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H25ClFN3O2/c1-15-19(23)4-3-5-20(15)25-22(29)16(2)26-10-12-27(13-11-26)21(28)14-17-6-8-18(24)9-7-17/h3-9,16H,10-14H2,1-2H3,(H,25,29) |
| InChIKey | OMCFIOPGRWVEGJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |