C18H21ClFN3OS — CID 30739460
(2S)-N-(4-chloro-2-fluorophenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propanamide (PubChem CID 30739460) has the molecular formula C18H21ClFN3OS and a molecular weight of 381.90 g/mol. Its IUPAC name is (2S)-N-(4-chloro-2-fluorophenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propanamide.
| Compound Name | (2S)-N-(4-chloro-2-fluorophenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 30739460 |
| Molecular Formula | C18H21ClFN3OS |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (2S)-N-(4-chloro-2-fluorophenyl)-2-[4-(thiophen-3-ylmethyl)piperazin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(Cl)cc1F)N1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C18H21ClFN3OS/c1-13(18(24)21-17-3-2-15(19)10-16(17)20)23-7-5-22(6-8-23)11-14-4-9-25-12-14/h2-4,9-10,12-13H,5-8,11H2,1H3,(H,21,24)/t13-/m0/s1 |
| InChIKey | PYTQOLLGYZOXSY-ZDUSSCGKSA-N |
| XLogP | 3.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |