C16H19FN3S2+ — CID 8564944
N-(2-fluorophenyl)-4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carbothioamide (PubChem CID 8564944) has the molecular formula C16H19FN3S2+ and a molecular weight of 336.48 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(2-fluorophenyl)-4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 8564944 |
| Molecular Formula | C16H19FN3S2+ |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-(2-fluorophenyl)-4-(thiophen-3-ylmethyl)piperazin-4-ium-1-carbothioamide |
| SMILES | Fc1ccccc1NC(=S)N1CC[NH+](Cc2ccsc2)CC1 |
| InChI | InChI=1S/C16H18FN3S2/c17-14-3-1-2-4-15(14)18-16(21)20-8-6-19(7-9-20)11-13-5-10-22-12-13/h1-5,10,12H,6-9,11H2,(H,18,21)/p+1 |
| InChIKey | WVZRUQXXBMIFJT-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|