C11H14FN3S — CID 82292486
N-(2-fluorophenyl)piperazine-1-carbothioamide (PubChem CID 82292486) has the molecular formula C11H14FN3S and a molecular weight of 239.32 g/mol. Its IUPAC name is N-(2-fluorophenyl)piperazine-1-carbothioamide.
| Compound Name | N-(2-fluorophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 82292486 |
| Molecular Formula | C11H14FN3S |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | N-(2-fluorophenyl)piperazine-1-carbothioamide |
| SMILES | Fc1ccccc1NC(=S)N1CCNCC1 |
| InChI | InChI=1S/C11H14FN3S/c12-9-3-1-2-4-10(9)14-11(16)15-7-5-13-6-8-15/h1-4,13H,5-8H2,(H,14,16) |
| InChIKey | WZFOIKFOMKRSCV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|