C11H12ClN3OS — CID 4967371
N-(2-chlorophenyl)-3-oxopiperazine-1-carbothioamide (PubChem CID 4967371) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-oxopiperazine-1-carbothioamide.
| Compound Name | N-(2-chlorophenyl)-3-oxopiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 4967371 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | N-(2-chlorophenyl)-3-oxopiperazine-1-carbothioamide |
| SMILES | O=C1CN(C(=S)Nc2ccccc2Cl)CCN1 |
| InChI | InChI=1S/C11H12ClN3OS/c12-8-3-1-2-4-9(8)14-11(17)15-6-5-13-10(16)7-15/h1-4H,5-7H2,(H,13,16)(H,14,17) |
| InChIKey | ZZZMZKNXBCZATI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|