C16H19FN4OS — CID 9284434
N-(2-fluorophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carbothioamide (PubChem CID 9284434) has the molecular formula C16H19FN4OS and a molecular weight of 334.42 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-(2-fluorophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 9284434 |
| Molecular Formula | C16H19FN4OS |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-(2-fluorophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carbothioamide |
| SMILES | Cc1cc(CN2CCN(C(=S)Nc3ccccc3F)CC2)no1 |
| InChI | InChI=1S/C16H19FN4OS/c1-12-10-13(19-22-12)11-20-6-8-21(9-7-20)16(23)18-15-5-3-2-4-14(15)17/h2-5,10H,6-9,11H2,1H3,(H,18,23) |
| InChIKey | ONJYIVMWQOEBCN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|