C18H21F3N4OS — CID 74225240
4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N-[2-(trifluoromethyl)phenyl]-1,4-diazepane-1-carbothioamide (PubChem CID 74225240) has the molecular formula C18H21F3N4OS and a molecular weight of 398.45 g/mol. Its IUPAC name is 4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N-[2-(trifluoromethyl)phenyl]-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N-[2-(trifluoromethyl)phenyl]-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 74225240 |
| Molecular Formula | C18H21F3N4OS |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N-[2-(trifluoromethyl)phenyl]-1,4-diazepane-1-carbothioamide |
| SMILES | Cc1cc(CN2CCCN(C(=S)Nc3ccccc3C(F)(F)F)CC2)no1 |
| InChI | InChI=1S/C18H21F3N4OS/c1-13-11-14(23-26-13)12-24-7-4-8-25(10-9-24)17(27)22-16-6-3-2-5-15(16)18(19,20)21/h2-3,5-6,11H,4,7-10,12H2,1H3,(H,22,27) |
| InChIKey | SMZDKJNJZDUEJH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|