C23H33F3N4OS — CID 3670383
2-[4-(cyclooctylcarbamothioyl)-1,4-diazepan-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 3670383) has the molecular formula C23H33F3N4OS and a molecular weight of 470.61 g/mol. Its IUPAC name is 2-[4-(cyclooctylcarbamothioyl)-1,4-diazepan-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(cyclooctylcarbamothioyl)-1,4-diazepan-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3670383 |
| Molecular Formula | C23H33F3N4OS |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 2-[4-(cyclooctylcarbamothioyl)-1,4-diazepan-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCCN(C(=S)NC2CCCCCCC2)CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H33F3N4OS/c24-23(25,26)19-11-6-7-12-20(19)28-21(31)17-29-13-8-14-30(16-15-29)22(32)27-18-9-4-2-1-3-5-10-18/h6-7,11-12,18H,1-5,8-10,13-17H2,(H,27,32)(H,28,31) |
| InChIKey | ZWMLUVBGHKHTSU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|